C23H28N4O5S — CID 135555678
[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135555678) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135555678 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CCN(c1ccc(NC(=O)COC(=O)C(C)/N=C2\NS(=O)(=O)c3ccccc32)cc1)C(C)C |
| InChI | InChI=1S/C23H28N4O5S/c1-5-27(15(2)3)18-12-10-17(11-13-18)25-21(28)14-32-23(29)16(4)24-22-19-8-6-7-9-20(19)33(30,31)26-22/h6-13,15-16H,5,14H2,1-4H3,(H,24,26)(H,25,28) |
| InChIKey | FCKWKCSKJHGKTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|