C31H24F2N4O4 — CID 135555935
N-[4-[[[2-[(E)-1-(3,5-difluorophenyl)-1-hydroxy-3-(3-hydroxyphenyl)-3-oxoprop-1-en-2-yl]-3H-benzimidazol-5-yl]amino]methyl]phenyl]acetamide (PubChem CID 135555935) has the molecular formula C31H24F2N4O4 and a molecular weight of 554.55 g/mol. Its IUPAC name is N-[4-[[[2-[(E)-1-(3,5-difluorophenyl)-1-hydroxy-3-(3-hydroxyphenyl)-3-oxoprop-1-en-2-yl]-3H-benzimidazol-5-yl]amino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[[2-[(E)-1-(3,5-difluorophenyl)-1-hydroxy-3-(3-hydroxyphenyl)-3-oxoprop-1-en-2-yl]-3H-benzimidazol-5-yl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 135555935 |
| Molecular Formula | C31H24F2N4O4 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | N-[4-[[[2-[(E)-1-(3,5-difluorophenyl)-1-hydroxy-3-(3-hydroxyphenyl)-3-oxoprop-1-en-2-yl]-3H-benzimidazol-5-yl]amino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNc2ccc3nc(/C(C(=O)c4cccc(O)c4)=C(\O)c4cc(F)cc(F)c4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C31H24F2N4O4/c1-17(38)35-23-7-5-18(6-8-23)16-34-24-9-10-26-27(15-24)37-31(36-26)28(29(40)19-3-2-4-25(39)13-19)30(41)20-11-21(32)14-22(33)12-20/h2-15,34,39,41H,16H2,1H3,(H,35,38)(H,36,37)/b30-28- |
| InChIKey | FGXAPSUURRDQLB-HYOGKJQXSA-N |
| XLogP | 6.43 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|