About 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile
3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile (PubChem CID 135555982) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile |
| PubChem CID | 135555982 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cccc(CCC#N)c2)c(=O)n1C |
| InChI | InChI=1S/C19H18N2O3/c1-13-11-17(23)18(19(24)21(13)2)16(22)9-8-15-6-3-5-14(12-15)7-4-10-20/h3,5-6,8-9,11-12,23H,4,7H2,1-2H3/b9-8+ |
| InChIKey | MIDMLEQVRYUECM-CMDGGOBGSA-N |
| XLogP | 2.75 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile?
The IUPAC name of 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile (CID 135555982) is 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile.
What is the SMILES notation for 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile?
The canonical SMILES for 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile is Cc1cc(O)c(C(=O)/C=C/c2cccc(CCC#N)c2)c(=O)n1C.
What is the InChIKey of 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile?
The InChIKey is MIDMLEQVRYUECM-CMDGGOBGSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-13-11-17(23)18(19(24)21(13)2)16(22)9-8-15-6-3-5-14(12-15)7-4-10-20/h3,5-6,8-9,11-12,23H,4,7H2,1-2H3/b9-8+.
What are the key properties of 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile?
3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile has a molecular weight of 322.36 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]phenyl]propanenitrile is sourced from PubChem (CID 135555982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).