About 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid
3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 135555996) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid |
| PubChem CID | 135555996 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cccc(C(=O)O)c2)c(=O)n1C |
| InChI | InChI=1S/C17H15NO5/c1-10-8-14(20)15(16(21)18(10)2)13(19)7-6-11-4-3-5-12(9-11)17(22)23/h3-9,20H,1-2H3,(H,22,23)/b7-6+ |
| InChIKey | BWKSRDQZDNOAJX-VOTSOKGWSA-N |
| XLogP | 1.99 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid?
The IUPAC name of 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid (CID 135555996) is 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid.
What is the SMILES notation for 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid?
The canonical SMILES for 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid is Cc1cc(O)c(C(=O)/C=C/c2cccc(C(=O)O)c2)c(=O)n1C.
What is the InChIKey of 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid?
The InChIKey is BWKSRDQZDNOAJX-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H15NO5/c1-10-8-14(20)15(16(21)18(10)2)13(19)7-6-11-4-3-5-12(9-11)17(22)23/h3-9,20H,1-2H3,(H,22,23)/b7-6+.
What are the key properties of 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid?
3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid has a molecular weight of 313.31 g/mol, XLogP of 1.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(4-hydroxy-1,6-dimethyl-2-oxo-3-pyridinyl)-3-oxoprop-1-enyl]benzoic acid is sourced from PubChem (CID 135555996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).