About 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one
4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one (PubChem CID 135556043) has the molecular formula C19H21NO5
and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one |
| PubChem CID | 135556043 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cccc(COCCO)c2)c(=O)n1C |
| InChI | InChI=1S/C19H21NO5/c1-13-10-17(23)18(19(24)20(13)2)16(22)7-6-14-4-3-5-15(11-14)12-25-9-8-21/h3-7,10-11,21,23H,8-9,12H2,1-2H3/b7-6+ |
| InChIKey | ZCFNBLMCLSKJMW-VOTSOKGWSA-N |
| XLogP | 1.80 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one?
The IUPAC name of 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one (CID 135556043) is 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one.
What is the SMILES notation for 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one?
The canonical SMILES for 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one is Cc1cc(O)c(C(=O)/C=C/c2cccc(COCCO)c2)c(=O)n1C.
What is the InChIKey of 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one?
The InChIKey is ZCFNBLMCLSKJMW-VOTSOKGWSA-N. The full InChI is InChI=1S/C19H21NO5/c1-13-10-17(23)18(19(24)20(13)2)16(22)7-6-14-4-3-5-15(11-14)12-25-9-8-21/h3-7,10-11,21,23H,8-9,12H2,1-2H3/b7-6+.
What are the key properties of 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one?
4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one has a molecular weight of 343.38 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-[(E)-3-[3-(2-hydroxyethoxymethyl)phenyl]prop-2-enoyl]-1,6-dimethylpyridin-2-one is sourced from PubChem (CID 135556043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).