C15H15BO2 — CID 135556148
(3aS,9aS)-2-cyclopenta-1,4-dien-1-yl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole (PubChem CID 135556148) has the molecular formula C15H15BO2 and a molecular weight of 238.10 g/mol. Its IUPAC name is (3aS,9aS)-2-cyclopenta-1,4-dien-1-yl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole.
| Compound Name | (3aS,9aS)-2-cyclopenta-1,4-dien-1-yl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole |
|---|---|
| PubChem CID | 135556148 |
| Molecular Formula | C15H15BO2 |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3aS,9aS)-2-cyclopenta-1,4-dien-1-yl-3a,4,9,9a-tetrahydrobenzo[f][1,3,2]benzodioxaborole |
| SMILES | C1=CC(B2O[C@H]3Cc4ccccc4C[C@@H]3O2)=CC1 |
| InChI | InChI=1S/C15H15BO2/c1-2-6-12-10-15-14(9-11(12)5-1)17-16(18-15)13-7-3-4-8-13/h1-3,5-8,14-15H,4,9-10H2/t14-,15-/m0/s1 |
| InChIKey | HZJLOVVXRQVTTB-GJZGRUSLSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|