C13H16N4O2 — CID 135556244
N-cyclohexyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135556244) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-cyclohexyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | N-cyclohexyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135556244 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-cyclohexyl-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | [O-][n+]1nc(NC2CCCCC2)[n+]([O-])c2ccccc21 |
| InChI | InChI=1S/C13H16N4O2/c18-16-11-8-4-5-9-12(11)17(19)15-13(16)14-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,14,15) |
| InChIKey | CLVCWDGEMHCLKQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|