About ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate
ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate (PubChem CID 135557738) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate |
| PubChem CID | 135557738 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate |
| SMILES | CCOC(=O)/N=N/c1c(O)[nH]c2c(C)cc(C)cc12 |
| InChI | InChI=1S/C13H15N3O3/c1-4-19-13(18)16-15-11-9-6-7(2)5-8(3)10(9)14-12(11)17/h5-6,14,17H,4H2,1-3H3/b16-15+ |
| InChIKey | MRGBQCJCWHZODV-FOCLMDBBSA-N |
| XLogP | 3.73 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate?
The IUPAC name of ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate (CID 135557738) is ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate.
What is the SMILES notation for ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate?
The canonical SMILES for ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate is CCOC(=O)/N=N/c1c(O)[nH]c2c(C)cc(C)cc12.
What is the InChIKey of ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate?
The InChIKey is MRGBQCJCWHZODV-FOCLMDBBSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-4-19-13(18)16-15-11-9-6-7(2)5-8(3)10(9)14-12(11)17/h5-6,14,17H,4H2,1-3H3/b16-15+.
What are the key properties of ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate?
ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate has a molecular weight of 261.28 g/mol, XLogP of 3.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(2-hydroxy-5,7-dimethyl-1H-indol-3-yl)imino]carbamate is sourced from PubChem (CID 135557738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).