C24H30N4O5 — CID 135557888
4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]benzamide (PubChem CID 135557888) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]benzamide.
| Compound Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135557888 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]benzamide |
| SMILES | Cc1ncc(CO)c(/C=N/NC(=O)c2ccc(OCC(=O)N3C(C)CCCC3C)cc2)c1O |
| InChI | InChI=1S/C24H30N4O5/c1-15-5-4-6-16(2)28(15)22(30)14-33-20-9-7-18(8-10-20)24(32)27-26-12-21-19(13-29)11-25-17(3)23(21)31/h7-12,15-16,29,31H,4-6,13-14H2,1-3H3,(H,27,32)/b26-12+ |
| InChIKey | LGLQDRHNOIVZJG-RPPGKUMJSA-N |
| XLogP | 2.52 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|