C16H19N3OS — CID 135558451
5-methyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 135558451) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 5-methyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135558451 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5-methyl-N-[(E)-1-(1H-pyrrol-2-yl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc2c(s1)CCC(C)C2)c1ccc[nH]1 |
| InChI | InChI=1S/C16H19N3OS/c1-10-5-6-14-12(8-10)9-15(21-14)16(20)19-18-11(2)13-4-3-7-17-13/h3-4,7,9-10,17H,5-6,8H2,1-2H3,(H,19,20)/b18-11+ |
| InChIKey | XQJCBSQYXUTYSZ-WOJGMQOQSA-N |
| XLogP | 3.36 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|