C20H23FN4O2S — CID 135558947
N-(2-fluorophenyl)-2-[(2E)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135558947) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(2E)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(2E)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135558947 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(2E)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC1=C/C(=N\N=C2/NC(=O)C(CC(=O)Nc3ccccc3F)S2)CC(C)(C)C1 |
| InChI | InChI=1S/C20H23FN4O2S/c1-12-8-13(11-20(2,3)10-12)24-25-19-23-18(27)16(28-19)9-17(26)22-15-7-5-4-6-14(15)21/h4-8,16H,9-11H2,1-3H3,(H,22,26)(H,23,25,27)/b24-13+ |
| InChIKey | MVGNAKQRMLHXJX-ZMOGYAJESA-N |
| XLogP | 3.86 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|