C29H36N8O4 — CID 135559080
(2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(4-oxo-3H-quinazolin-2-yl)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 135559080) has the molecular formula C29H36N8O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(4-oxo-3H-quinazolin-2-yl)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(4-oxo-3H-quinazolin-2-yl)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135559080 |
| Molecular Formula | C29H36N8O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | (2S)-N-[5-(diaminomethylideneamino)-1-oxo-1-(4-oxo-3H-quinazolin-2-yl)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C29H36N8O4/c1-32-22(17-18-9-3-2-4-10-18)28(41)37-16-8-14-23(37)27(40)35-21(13-7-15-33-29(30)31)24(38)25-34-20-12-6-5-11-19(20)26(39)36-25/h2-6,9-12,21-23,32H,7-8,13-17H2,1H3,(H,35,40)(H4,30,31,33)(H,34,36,39)/t21?,22-,23+/m1/s1 |
| InChIKey | DSBAJYNIVIRLCB-NRSZHQCHSA-N |
| XLogP | 0.47 |
| TPSA | 188.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|