C33H41N5O8S — CID 135559151
S-(methylamino) 4,5-bis[4-[bis(2-hydroxyethyl)amino]phenyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)imidazole-1-carbothioate (PubChem CID 135559151) has the molecular formula C33H41N5O8S and a molecular weight of 667.78 g/mol. Its IUPAC name is S-(methylamino) 4,5-bis[4-[bis(2-hydroxyethyl)amino]phenyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)imidazole-1-carbothioate.
| Compound Name | S-(methylamino) 4,5-bis[4-[bis(2-hydroxyethyl)amino]phenyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)imidazole-1-carbothioate |
|---|---|
| PubChem CID | 135559151 |
| Molecular Formula | C33H41N5O8S |
| Molecular Weight | 667.78 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | S-(methylamino) 4,5-bis[4-[bis(2-hydroxyethyl)amino]phenyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)imidazole-1-carbothioate |
| SMILES | CNSC(=O)n1c(-c2cc(OC)c(O)c(OC)c2)nc(-c2ccc(N(CCO)CCO)cc2)c1-c1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C33H41N5O8S/c1-34-47-33(44)38-30(23-6-10-26(11-7-23)37(14-18-41)15-19-42)29(22-4-8-25(9-5-22)36(12-16-39)13-17-40)35-32(38)24-20-27(45-2)31(43)28(21-24)46-3/h4-11,20-21,34,39-43H,12-19H2,1-3H3 |
| InChIKey | YGNUIEGVKBCZJB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 173.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|