About 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one
6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one (PubChem CID 135559640) has the molecular formula C21H13Cl3N2O2
and a molecular weight of 431.71 g/mol. Its IUPAC name is 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one |
| PubChem CID | 135559640 |
| Molecular Formula | C21H13Cl3N2O2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)/C2=N\c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H13Cl3N2O2/c1-11-16(23)8-7-15-19(11)26-21(27)20(15)25-13-3-5-14(6-4-13)28-18-9-2-12(22)10-17(18)24/h2-10H,1H3,(H,25,26,27) |
| InChIKey | VJZXVLLHXUHDNA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one?
The IUPAC name of 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one (CID 135559640) is 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one.
What is the SMILES notation for 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one?
The canonical SMILES for 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one is Cc1c(Cl)ccc2c1NC(=O)/C2=N\c1ccc(Oc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one?
The InChIKey is VJZXVLLHXUHDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl3N2O2/c1-11-16(23)8-7-15-19(11)26-21(27)20(15)25-13-3-5-14(6-4-13)28-18-9-2-12(22)10-17(18)24/h2-10H,1H3,(H,25,26,27).
What are the key properties of 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one?
6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one has a molecular weight of 431.71 g/mol, XLogP of 6.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[4-(2,4-dichlorophenoxy)phenyl]imino-7-methyl-1H-indol-2-one is sourced from PubChem (CID 135559640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).