C22H18BrN3O3 — CID 135560215
N-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 135560215) has the molecular formula C22H18BrN3O3 and a molecular weight of 452.31 g/mol. Its IUPAC name is N-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 135560215 |
| Molecular Formula | C22H18BrN3O3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-[4-[[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)N/N=C/c3cc(Br)ccc3O)cc2)c1 |
| InChI | InChI=1S/C22H18BrN3O3/c1-14-3-2-4-16(11-14)21(28)25-19-8-5-15(6-9-19)22(29)26-24-13-17-12-18(23)7-10-20(17)27/h2-13,27H,1H3,(H,25,28)(H,26,29)/b24-13+ |
| InChIKey | SGDNBPLVWZAXOR-ZMOGYAJESA-N |
| XLogP | 4.48 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|