C17H13BrN2O4 — CID 135560630
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 135560630) has the molecular formula C17H13BrN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 135560630 |
| Molecular Formula | C17H13BrN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(Br)o1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H13BrN2O4/c1-10(23-15(21)9-7-11-6-8-14(18)24-11)16-19-13-5-3-2-4-12(13)17(22)20-16/h2-10H,1H3,(H,19,20,22)/b9-7+/t10-/m0/s1 |
| InChIKey | PZEIUDLJNTVWEV-PCYYEKQGSA-N |
| XLogP | 3.60 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|