C19H21ClN2OS2 — CID 135560657
(2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(5-chlorothiophen-2-yl)-N-cyclopropyl-3-oxopropanimidothioate (PubChem CID 135560657) has the molecular formula C19H21ClN2OS2 and a molecular weight of 392.98 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(5-chlorothiophen-2-yl)-N-cyclopropyl-3-oxopropanimidothioate.
| Compound Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(5-chlorothiophen-2-yl)-N-cyclopropyl-3-oxopropanimidothioate |
|---|---|
| PubChem CID | 135560657 |
| Molecular Formula | C19H21ClN2OS2 |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2S)-2-(4-tert-butylpyridin-1-ium-1-yl)-3-(5-chlorothiophen-2-yl)-N-cyclopropyl-3-oxopropanimidothioate |
| SMILES | CC(C)(C)c1cc[n+]([C@@H](C(=O)c2ccc(Cl)s2)/C([S-])=N/C2CC2)cc1 |
| InChI | InChI=1S/C19H21ClN2OS2/c1-19(2,3)12-8-10-22(11-9-12)16(18(24)21-13-4-5-13)17(23)14-6-7-15(20)25-14/h6-11,13,16H,4-5H2,1-3H3/t16-/m0/s1 |
| InChIKey | QKTUVMKHABWOTK-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|