C17H15ClN4O2 — CID 135561041
6-benzyl-3-(5-chloro-2-methoxyanilino)-4H-1,2,4-triazin-5-one (PubChem CID 135561041) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 6-benzyl-3-(5-chloro-2-methoxyanilino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-benzyl-3-(5-chloro-2-methoxyanilino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135561041 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 6-benzyl-3-(5-chloro-2-methoxyanilino)-4H-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Cl)cc1Nc1nnc(Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H15ClN4O2/c1-24-15-8-7-12(18)10-13(15)19-17-20-16(23)14(21-22-17)9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H2,19,20,22,23) |
| InChIKey | VXAKNBPUTKSBHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |