C13H15FN4O2 — CID 135561188
6-[(4-fluorophenyl)methyl]-3-(3-hydroxypropylamino)-4H-1,2,4-triazin-5-one (PubChem CID 135561188) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-3-(3-hydroxypropylamino)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[(4-fluorophenyl)methyl]-3-(3-hydroxypropylamino)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135561188 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-3-(3-hydroxypropylamino)-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(NCCCO)nnc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN4O2/c14-10-4-2-9(3-5-10)8-11-12(20)16-13(18-17-11)15-6-1-7-19/h2-5,19H,1,6-8H2,(H2,15,16,18,20) |
| InChIKey | FUVNVVRLGHNZPP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|