C7H7F3N2OS — CID 135561636
2-ethylsulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135561636) has the molecular formula C7H7F3N2OS and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-ethylsulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-ethylsulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135561636 |
| Molecular Formula | C7H7F3N2OS |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-ethylsulfanyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CCSc1nc(C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H7F3N2OS/c1-2-14-6-11-4(7(8,9)10)3-5(13)12-6/h3H,2H2,1H3,(H,11,12,13) |
| InChIKey | SGRGYWVPMIRUTA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |