C11H8F3N3OS — CID 135561708
2-(pyridin-3-ylmethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135561708) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(pyridin-3-ylmethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135561708 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(pyridin-3-ylmethylsulfanyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(SCc2cccnc2)[nH]1 |
| InChI | InChI=1S/C11H8F3N3OS/c12-11(13,14)8-4-9(18)17-10(16-8)19-6-7-2-1-3-15-5-7/h1-5H,6H2,(H,16,17,18) |
| InChIKey | UNHBUKPYWOPICO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |