C18H19N3OS2 — CID 135563100
(5E)-2-[4-(diethylamino)phenyl]imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135563100) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (5E)-2-[4-(diethylamino)phenyl]imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-[4-(diethylamino)phenyl]imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135563100 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5E)-2-[4-(diethylamino)phenyl]imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/N=C2\NC(=O)/C(=C\c3cccs3)S2)cc1 |
| InChI | InChI=1S/C18H19N3OS2/c1-3-21(4-2)14-9-7-13(8-10-14)19-18-20-17(22)16(24-18)12-15-6-5-11-23-15/h5-12H,3-4H2,1-2H3,(H,19,20,22)/b16-12+ |
| InChIKey | GVIBQFICTOSXCW-FOWTUZBSSA-N |
| XLogP | 4.49 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|