C20H20N4O2S — CID 135563498
3-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-indole (PubChem CID 135563498) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-indole.
| Compound Name | 3-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-indole |
|---|---|
| PubChem CID | 135563498 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-indole |
| SMILES | COc1ccccc1OCCSc1nnc(-c2c[nH]c3ccccc23)n1C |
| InChI | InChI=1S/C20H20N4O2S/c1-24-19(15-13-21-16-8-4-3-7-14(15)16)22-23-20(24)27-12-11-26-18-10-6-5-9-17(18)25-2/h3-10,13,21H,11-12H2,1-2H3 |
| InChIKey | XNTKYAPSWMAMCP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|