About 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide
5-methyl-2,4-dioxopyrimidine-1-carbohydrazide (PubChem CID 135563820) has the molecular formula C6H8N4O3
and a molecular weight of 184.16 g/mol. Its IUPAC name is 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide |
| PubChem CID | 135563820 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide |
| SMILES | Cc1cn(C(=O)NN)c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c1-3-2-10(6(13)9-7)5(12)8-4(3)11/h2H,7H2,1H3,(H,9,13)(H,8,11,12) |
| InChIKey | YTBNPNNTMWTDHR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide?
The IUPAC name of 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide (CID 135563820) is 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide.
What is the SMILES notation for 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide?
The canonical SMILES for 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide is Cc1cn(C(=O)NN)c(=O)[nH]c1=O.
What is the InChIKey of 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide?
The InChIKey is YTBNPNNTMWTDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3/c1-3-2-10(6(13)9-7)5(12)8-4(3)11/h2H,7H2,1H3,(H,9,13)(H,8,11,12).
What are the key properties of 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide?
5-methyl-2,4-dioxopyrimidine-1-carbohydrazide has a molecular weight of 184.16 g/mol, XLogP of -1.72, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-dioxopyrimidine-1-carbohydrazide is sourced from PubChem (CID 135563820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).