About sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate
sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 135564781) has the molecular formula C10H9N2NaO3S
and a molecular weight of 260.25 g/mol. Its IUPAC name is sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
| PubChem CID | 135564781 |
| Molecular Formula | C10H9N2NaO3S |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | C[C@]1(C(=O)[O-])CSC(c2ncccc2O)=N1.[Na+] |
| InChI | InChI=1S/C10H10N2O3S.Na/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7;/h2-4,13H,5H2,1H3,(H,14,15);/q;+1/p-1/t10-;/m1./s1 |
| InChIKey | UGJSEILLHZKUBG-HNCPQSOCSA-M |
| XLogP | -3.21 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate?
The IUPAC name of sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate (CID 135564781) is sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate.
What is the SMILES notation for sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate?
The canonical SMILES for sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate is C[C@]1(C(=O)[O-])CSC(c2ncccc2O)=N1.[Na+].
What is the InChIKey of sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate?
The InChIKey is UGJSEILLHZKUBG-HNCPQSOCSA-M. The full InChI is InChI=1S/C10H10N2O3S.Na/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7;/h2-4,13H,5H2,1H3,(H,14,15);/q;+1/p-1/t10-;/m1./s1.
What are the key properties of sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate?
sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate has a molecular weight of 260.25 g/mol, XLogP of -3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (4S)-2-(3-hydroxy-2-pyridinyl)-4-methyl-5H-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 135564781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).