C7H11N5O — CID 135564797
(6S)-2-amino-6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135564797) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is (6S)-2-amino-6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | (6S)-2-amino-6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135564797 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (6S)-2-amino-6-methyl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | C[C@H]1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C7H11N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h3,10H,2H2,1H3,(H4,8,9,11,12,13)/t3-/m0/s1 |
| InChIKey | HWOZEJJVUCALGB-VKHMYHEASA-N |
| XLogP | -0.42 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |