C34H34CuN4O6 — CID 135565134
copper [(17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18,24-dihydro-17H-porphyrin-2-ylidene]methanediolate (PubChem CID 135565134) has the molecular formula C34H34CuN4O6 and a molecular weight of 658.21 g/mol. Its IUPAC name is copper [(17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18,24-dihydro-17H-porphyrin-2-ylidene]methanediolate.
| Compound Name | copper [(17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18,24-dihydro-17H-porphyrin-2-ylidene]methanediolate |
|---|---|
| PubChem CID | 135565134 |
| Molecular Formula | C34H34CuN4O6 |
| Molecular Weight | 658.21 g/mol |
| Exact Mass | 657.18 |
| IUPAC Name | copper [(17S,18S)-18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-18,24-dihydro-17H-porphyrin-2-ylidene]methanediolate |
| SMILES | C=CC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=C(C)C(=C([O-])[O-])C(=N3)/C(CC(=O)O)=C3\N/C(=C\2)[C@@H](C)[C@@H]3CCC(=O)O)C(CC)=C1C.[Cu+2] |
| InChI | InChI=1S/C34H36N4O6.Cu/c1-7-19-15(3)23-12-25-17(5)21(9-10-29(39)40)32(37-25)22(11-30(41)42)33-31(34(43)44)18(6)26(38-33)14-28-20(8-2)16(4)24(36-28)13-27(19)35-23;/h7,12-14,17,21,37,43-44H,1,8-11H2,2-6H3,(H,39,40)(H,41,42);/q;+2/p-2/b25-12-,27-13-,28-14-,32-22-;/t17-,21-;/m0./s1 |
| InChIKey | UFWOHWBPKWVAAB-QTHSFPECSA-L |
| XLogP | 3.90 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|