C9H19N3O7 — CID 135565640
(1R,2S,3R)-1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;dihydrate (PubChem CID 135565640) has the molecular formula C9H19N3O7 and a molecular weight of 281.27 g/mol. Its IUPAC name is (1R,2S,3R)-1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;dihydrate.
| Compound Name | (1R,2S,3R)-1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;dihydrate |
|---|---|
| PubChem CID | 135565640 |
| Molecular Formula | C9H19N3O7 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1R,2S,3R)-1-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-1H-imidazol-5-yl]butane-1,2,3,4-tetrol;dihydrate |
| SMILES | C/C(=N\O)c1ncc([C@@H](O)[C@H](O)[C@H](O)CO)[nH]1.O.O |
| InChI | InChI=1S/C9H15N3O5.2H2O/c1-4(12-17)9-10-2-5(11-9)7(15)8(16)6(14)3-13;;/h2,6-8,13-17H,3H2,1H3,(H,10,11);2*1H2/b12-4+;;/t6-,7-,8-;;/m1../s1 |
| InChIKey | AJVKDZILVNPFFC-ZQBMOEMVSA-N |
| XLogP | -3.29 |
| TPSA | 205.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|