C25H34N6O3 — CID 135566112
Acetildenafil (PubChem CID 135566112) has the molecular formula C25H34N6O3 and a molecular weight of 466.60 g/mol. Its IUPAC name is 5-[2-ethoxy-5-[2-(4-ethylpiperazin-1-yl)acetyl]phenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | Acetildenafil |
|---|---|
| PubChem CID | 135566112 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 5-[2-ethoxy-5-[2-(4-ethylpiperazin-1-yl)acetyl]phenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(CC4)CC)OCC)C |
| InChI | InChI=1S/C25H34N6O3/c1-5-8-19-22-23(29(4)28-19)25(33)27-24(26-22)18-15-17(9-10-21(18)34-7-3)20(32)16-31-13-11-30(6-2)12-14-31/h9-10,15H,5-8,11-14,16H2,1-4H3,(H,26,27,33) |
| InChIKey | RRBRQNALHKQCAI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | 753 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |