C10H18N5O7P — CID 135566172
[(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135566172) has the molecular formula C10H18N5O7P and a molecular weight of 351.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135566172 |
| Molecular Formula | C10H18N5O7P |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2,3,7,8-tetrahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC1=NCNC2=C1NCN2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h4,6-7,10,13-14,16-17H,1-3H2,(H2,11,12)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | FTRONTAQGNVDQB-KQYNXXCUSA-N |
| XLogP | -3.51 |
| TPSA | 182.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|