About 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol
4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol (PubChem CID 135566325) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol |
| PubChem CID | 135566325 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2nc3ccccc3o2)cc(C)c1O |
| InChI | InChI=1S/C15H13NO2/c1-9-7-11(8-10(2)14(9)17)15-16-12-5-3-4-6-13(12)18-15/h3-8,17H,1-2H3 |
| InChIKey | NORYHCMDDBZXDX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol?
The IUPAC name of 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol (CID 135566325) is 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol.
What is the SMILES notation for 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol?
The canonical SMILES for 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol is Cc1cc(-c2nc3ccccc3o2)cc(C)c1O.
What is the InChIKey of 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol?
The InChIKey is NORYHCMDDBZXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c1-9-7-11(8-10(2)14(9)17)15-16-12-5-3-4-6-13(12)18-15/h3-8,17H,1-2H3.
What are the key properties of 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol?
4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol has a molecular weight of 239.27 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-yl)-2,6-dimethylphenol is sourced from PubChem (CID 135566325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).