About 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol
4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol (PubChem CID 135566326) has the molecular formula C13H7Br2NO2
and a molecular weight of 369.01 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol.
Molecular Properties
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol |
| PubChem CID | 135566326 |
| Molecular Formula | C13H7Br2NO2 |
| Molecular Weight | 369.01 g/mol |
| Exact Mass | 366.88 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol |
| SMILES | Oc1c(Br)cc(-c2nc3ccccc3o2)cc1Br |
| InChI | InChI=1S/C13H7Br2NO2/c14-8-5-7(6-9(15)12(8)17)13-16-10-3-1-2-4-11(10)18-13/h1-6,17H |
| InChIKey | DMOJYCAJRLAKQW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.01 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol?
The IUPAC name of 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol (CID 135566326) is 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol.
What is the SMILES notation for 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol?
The canonical SMILES for 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol is Oc1c(Br)cc(-c2nc3ccccc3o2)cc1Br.
What is the InChIKey of 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol?
The InChIKey is DMOJYCAJRLAKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Br2NO2/c14-8-5-7(6-9(15)12(8)17)13-16-10-3-1-2-4-11(10)18-13/h1-6,17H.
What are the key properties of 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol?
4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol has a molecular weight of 369.01 g/mol, XLogP of 4.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzoxazol-2-yl)-2,6-dibromophenol is sourced from PubChem (CID 135566326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).