C12H20N4O7 — CID 135566348
N-[(5S)-2,4-dioxo-6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]imino-1,3-diazinan-5-yl]propanamide (PubChem CID 135566348) has the molecular formula C12H20N4O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is N-[(5S)-2,4-dioxo-6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]imino-1,3-diazinan-5-yl]propanamide.
| Compound Name | N-[(5S)-2,4-dioxo-6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]imino-1,3-diazinan-5-yl]propanamide |
|---|---|
| PubChem CID | 135566348 |
| Molecular Formula | C12H20N4O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(5S)-2,4-dioxo-6-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]imino-1,3-diazinan-5-yl]propanamide |
| SMILES | CCC(=O)N[C@@H]1C(=O)NC(=O)N/C1=N\C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H20N4O7/c1-2-7(20)14-8-10(15-12(23)16-11(8)22)13-3-5(18)9(21)6(19)4-17/h5-6,8-9,17-19,21H,2-4H2,1H3,(H,14,20)(H2,13,15,16,22,23)/t5-,6+,8-,9-/m0/s1 |
| InChIKey | NPNFNBTUUJYCDD-FAYXRDSDSA-N |
| XLogP | -3.81 |
| TPSA | 180.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|