About 3-methyl-2H-indazol-6-ol
3-methyl-2H-indazol-6-ol (PubChem CID 135566389) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-methyl-2H-indazol-6-ol.
Molecular Properties
| Compound Name | 3-methyl-2H-indazol-6-ol |
| PubChem CID | 135566389 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3-methyl-2H-indazol-6-ol |
| SMILES | Cc1[nH]nc2cc(O)ccc12 |
| InChI | InChI=1S/C8H8N2O/c1-5-7-3-2-6(11)4-8(7)10-9-5/h2-4,11H,1H3,(H,9,10) |
| InChIKey | WTNPPQUZRFSUQF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2H-indazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-indazol-6-ol?
The IUPAC name of 3-methyl-2H-indazol-6-ol (CID 135566389) is 3-methyl-2H-indazol-6-ol.
What is the SMILES notation for 3-methyl-2H-indazol-6-ol?
The canonical SMILES for 3-methyl-2H-indazol-6-ol is Cc1[nH]nc2cc(O)ccc12.
What is the InChIKey of 3-methyl-2H-indazol-6-ol?
The InChIKey is WTNPPQUZRFSUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-5-7-3-2-6(11)4-8(7)10-9-5/h2-4,11H,1H3,(H,9,10).
What are the key properties of 3-methyl-2H-indazol-6-ol?
3-methyl-2H-indazol-6-ol has a molecular weight of 148.16 g/mol, XLogP of 1.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-indazol-6-ol is sourced from PubChem (CID 135566389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).