C9H8N6O — CID 135566394
2,6-diamino-1,7-dihydroimidazo[4,5-g]quinazolin-8-one (PubChem CID 135566394) has the molecular formula C9H8N6O and a molecular weight of 216.20 g/mol. Its IUPAC name is 2,6-diamino-1,7-dihydroimidazo[4,5-g]quinazolin-8-one.
| Compound Name | 2,6-diamino-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 135566394 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2,6-diamino-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
| SMILES | Nc1nc2cc3nc(N)[nH]c3cc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N6O/c10-8-13-5-1-3-4(2-6(5)14-8)12-9(11)15-7(3)16/h1-2H,(H3,10,13,14)(H3,11,12,15,16) |
| InChIKey | WFECBOHPSURSGU-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |