About (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one
(6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one (PubChem CID 135566472) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one.
Molecular Properties
| Compound Name | (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one |
| PubChem CID | 135566472 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one |
| SMILES | C[C@@H]1CN=c2nc(N)[nH]c(=O)c2=N1 |
| InChI | InChI=1S/C7H9N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h3H,2H2,1H3,(H3,8,9,11,12,13)/t3-/m1/s1 |
| InChIKey | QARNTSWBYSPKTL-GSVOUGTGSA-N |
| XLogP | -2.01 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one?
The IUPAC name of (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one (CID 135566472) is (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one.
What is the SMILES notation for (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one?
The canonical SMILES for (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one is C[C@@H]1CN=c2nc(N)[nH]c(=O)c2=N1.
What is the InChIKey of (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one?
The InChIKey is QARNTSWBYSPKTL-GSVOUGTGSA-N. The full InChI is InChI=1S/C7H9N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h3H,2H2,1H3,(H3,8,9,11,12,13)/t3-/m1/s1.
What are the key properties of (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one?
(6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one has a molecular weight of 179.18 g/mol, XLogP of -2.01, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-amino-6-methyl-6,7-dihydro-3H-pteridin-4-one is sourced from PubChem (CID 135566472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).