C11H17N4O5P — CID 135566536
[(3S)-4-hydroxy-3-[(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butyl]phosphonic acid (PubChem CID 135566536) has the molecular formula C11H17N4O5P and a molecular weight of 316.25 g/mol. Its IUPAC name is [(3S)-4-hydroxy-3-[(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butyl]phosphonic acid.
| Compound Name | [(3S)-4-hydroxy-3-[(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butyl]phosphonic acid |
|---|---|
| PubChem CID | 135566536 |
| Molecular Formula | C11H17N4O5P |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [(3S)-4-hydroxy-3-[(4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)methylamino]butyl]phosphonic acid |
| SMILES | O=c1[nH]cnc2c(CN[C@H](CO)CCP(=O)(O)O)c[nH]c12 |
| InChI | InChI=1S/C11H17N4O5P/c16-5-8(1-2-21(18,19)20)12-3-7-4-13-10-9(7)14-6-15-11(10)17/h4,6,8,12-13,16H,1-3,5H2,(H,14,15,17)(H2,18,19,20)/t8-/m0/s1 |
| InChIKey | YYXVNWBGVIIBOW-QMMMGPOBSA-N |
| XLogP | -0.73 |
| TPSA | 151.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|