C9H8FN5O — CID 135566557
2-(4,6-diamino-1,3,5-triazin-2-yl)-4-fluorophenol (PubChem CID 135566557) has the molecular formula C9H8FN5O and a molecular weight of 221.20 g/mol. Its IUPAC name is 2-(4,6-diamino-1,3,5-triazin-2-yl)-4-fluorophenol.
| Compound Name | 2-(4,6-diamino-1,3,5-triazin-2-yl)-4-fluorophenol |
|---|---|
| PubChem CID | 135566557 |
| Molecular Formula | C9H8FN5O |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(4,6-diamino-1,3,5-triazin-2-yl)-4-fluorophenol |
| SMILES | Nc1nc(N)nc(-c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C9H8FN5O/c10-4-1-2-6(16)5(3-4)7-13-8(11)15-9(12)14-7/h1-3,16H,(H4,11,12,13,14,15) |
| InChIKey | LESNOWHOOHPPHR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |