About 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol
2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol (PubChem CID 135566618) has the molecular formula C16H15N3OS
and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol |
| PubChem CID | 135566618 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc2cc(-c3n[nH]c4ccsc34)[nH]c2c1 |
| InChI | InChI=1S/C16H15N3OS/c1-16(2,20)10-4-3-9-7-13(17-12(9)8-10)14-15-11(18-19-14)5-6-21-15/h3-8,17,20H,1-2H3,(H,18,19) |
| InChIKey | FVSUKLKFSDSIEF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol?
The IUPAC name of 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol (CID 135566618) is 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol.
What is the SMILES notation for 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol?
The canonical SMILES for 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol is CC(C)(O)c1ccc2cc(-c3n[nH]c4ccsc34)[nH]c2c1.
What is the InChIKey of 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol?
The InChIKey is FVSUKLKFSDSIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3OS/c1-16(2,20)10-4-3-9-7-13(17-12(9)8-10)14-15-11(18-19-14)5-6-21-15/h3-8,17,20H,1-2H3,(H,18,19).
What are the key properties of 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol?
2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol has a molecular weight of 297.38 g/mol, XLogP of 4.00, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1H-thieno[3,2-c]pyrazol-3-yl)-1H-indol-6-yl]propan-2-ol is sourced from PubChem (CID 135566618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).