About 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile
2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 135566677) has the molecular formula C15H11N5O
and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| PubChem CID | 135566677 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(/C=C/c2ccccc2)[nH]c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C15H11N5O/c16-8-10-11(7-6-9-4-2-1-3-5-9)18-13-12(10)14(21)20-15(17)19-13/h1-7H,(H4,17,18,19,20,21)/b7-6+ |
| InChIKey | WPTUPLITBGLORN-VOTSOKGWSA-N |
| XLogP | 1.88 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The IUPAC name of 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile (CID 135566677) is 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The canonical SMILES for 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile is N#Cc1c(/C=C/c2ccccc2)[nH]c2nc(N)[nH]c(=O)c12.
What is the InChIKey of 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The InChIKey is WPTUPLITBGLORN-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H11N5O/c16-8-10-11(7-6-9-4-2-1-3-5-9)18-13-12(10)14(21)20-15(17)19-13/h1-7H,(H4,17,18,19,20,21)/b7-6+.
What are the key properties of 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile?
2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile has a molecular weight of 277.29 g/mol, XLogP of 1.88, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-oxo-6-[(E)-2-phenylethenyl]-3,7-dihydropyrrolo[2,3-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 135566677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).