C8H12N6O — CID 135566759
(6aS)-3-amino-5,6,6a,7,8,9-hexahydro-2H-imidazo[1,5-f]pteridin-1-one (PubChem CID 135566759) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is (6aS)-3-amino-5,6,6a,7,8,9-hexahydro-2H-imidazo[1,5-f]pteridin-1-one.
| Compound Name | (6aS)-3-amino-5,6,6a,7,8,9-hexahydro-2H-imidazo[1,5-f]pteridin-1-one |
|---|---|
| PubChem CID | 135566759 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (6aS)-3-amino-5,6,6a,7,8,9-hexahydro-2H-imidazo[1,5-f]pteridin-1-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)N1CNC[C@H]1CN2 |
| InChI | InChI=1S/C8H12N6O/c9-8-12-6-5(7(15)13-8)14-3-10-1-4(14)2-11-6/h4,10H,1-3H2,(H4,9,11,12,13,15)/t4-/m0/s1 |
| InChIKey | SYLVEQOLXDQBGI-BYPYZUCNSA-N |
| XLogP | -1.49 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |