About 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one
2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one (PubChem CID 135566834) has the molecular formula C16H12N4OS
and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one |
| PubChem CID | 135566834 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one |
| SMILES | Nc1nc2[nH]c3cccc(Sc4ccccc4)c3c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H12N4OS/c17-16-19-14-13(15(21)20-16)12-10(18-14)7-4-8-11(12)22-9-5-2-1-3-6-9/h1-8H,(H4,17,18,19,20,21) |
| InChIKey | RURPYDOTPJEGPP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one?
The IUPAC name of 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one (CID 135566834) is 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one.
What is the SMILES notation for 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one?
The canonical SMILES for 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one is Nc1nc2[nH]c3cccc(Sc4ccccc4)c3c2c(=O)[nH]1.
What is the InChIKey of 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one?
The InChIKey is RURPYDOTPJEGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4OS/c17-16-19-14-13(15(21)20-16)12-10(18-14)7-4-8-11(12)22-9-5-2-1-3-6-9/h1-8H,(H4,17,18,19,20,21).
What are the key properties of 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one?
2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one has a molecular weight of 308.37 g/mol, XLogP of 3.14, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-phenylsulfanyl-3,9-dihydropyrimido[4,5-b]indol-4-one is sourced from PubChem (CID 135566834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).