C17H13N3O5 — CID 135567038
2-[2-hydroxy-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]pyridine-4-carboxylic acid (PubChem CID 135567038) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-hydroxy-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 135567038 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[2-hydroxy-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]pyridine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(O)c(-c3cc(C(=O)O)ccn3)c2)no1 |
| InChI | InChI=1S/C17H13N3O5/c1-9-6-14(20-25-9)16(22)19-11-2-3-15(21)12(8-11)13-7-10(17(23)24)4-5-18-13/h2-8,21H,1H3,(H,19,22)(H,23,24) |
| InChIKey | SXVDKQLIPBWXCB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|