C21H18N2O5 — CID 135567042
2-[2-hydroxy-5-[[2-(3-methoxyphenyl)acetyl]amino]phenyl]pyridine-4-carboxylic acid (PubChem CID 135567042) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[[2-(3-methoxyphenyl)acetyl]amino]phenyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-hydroxy-5-[[2-(3-methoxyphenyl)acetyl]amino]phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 135567042 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[2-hydroxy-5-[[2-(3-methoxyphenyl)acetyl]amino]phenyl]pyridine-4-carboxylic acid |
| SMILES | COc1cccc(CC(=O)Nc2ccc(O)c(-c3cc(C(=O)O)ccn3)c2)c1 |
| InChI | InChI=1S/C21H18N2O5/c1-28-16-4-2-3-13(9-16)10-20(25)23-15-5-6-19(24)17(12-15)18-11-14(21(26)27)7-8-22-18/h2-9,11-12,24H,10H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | QSWJSOQQNWMPME-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|