C22H21F4N5O — CID 135567081
(5R,7S)-5-(4-ethylphenyl)-N-[(5-fluoro-2-pyridinyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 135567081) has the molecular formula C22H21F4N5O and a molecular weight of 447.44 g/mol. Its IUPAC name is (5R,7S)-5-(4-ethylphenyl)-N-[(5-fluoro-2-pyridinyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7S)-5-(4-ethylphenyl)-N-[(5-fluoro-2-pyridinyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 135567081 |
| Molecular Formula | C22H21F4N5O |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | (5R,7S)-5-(4-ethylphenyl)-N-[(5-fluoro-2-pyridinyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCc1ccc([C@H]2C[C@@H](C(F)(F)F)n3ncc(C(=O)NCc4ccc(F)cn4)c3N2)cc1 |
| InChI | InChI=1S/C22H21F4N5O/c1-2-13-3-5-14(6-4-13)18-9-19(22(24,25)26)31-20(30-18)17(12-29-31)21(32)28-11-16-8-7-15(23)10-27-16/h3-8,10,12,18-19,30H,2,9,11H2,1H3,(H,28,32)/t18-,19+/m1/s1 |
| InChIKey | AURWIOYIXRLAMD-MOPGFXCFSA-N |
| XLogP | 4.57 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |