About 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol
4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol (PubChem CID 135567151) has the molecular formula C22H19N3O3
and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol |
| PubChem CID | 135567151 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol |
| SMILES | Oc1ccc(CNc2n[nH]c(-c3ccc(O)cc3)c2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c26-17-7-1-14(2-8-17)13-23-22-20(15-3-9-18(27)10-4-15)21(24-25-22)16-5-11-19(28)12-6-16/h1-12,26-28H,13H2,(H2,23,24,25) |
| InChIKey | YRRFETZFOOWFGO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol?
The IUPAC name of 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol (CID 135567151) is 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol.
What is the SMILES notation for 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol?
The canonical SMILES for 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol is Oc1ccc(CNc2n[nH]c(-c3ccc(O)cc3)c2-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol?
The InChIKey is YRRFETZFOOWFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3/c26-17-7-1-14(2-8-17)13-23-22-20(15-3-9-18(27)10-4-15)21(24-25-22)16-5-11-19(28)12-6-16/h1-12,26-28H,13H2,(H2,23,24,25).
What are the key properties of 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol?
4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol has a molecular weight of 373.41 g/mol, XLogP of 4.47, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[4,5-bis(4-hydroxyphenyl)-1H-pyrazol-3-yl]amino]methyl]phenol is sourced from PubChem (CID 135567151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).