About [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone
[6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone (PubChem CID 135567153) has the molecular formula C18H12FNO4
and a molecular weight of 325.30 g/mol. Its IUPAC name is [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone |
| PubChem CID | 135567153 |
| Molecular Formula | C18H12FNO4 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(F)c(O)c1)c1cccc(-c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C18H12FNO4/c19-12-6-4-11(9-16(12)22)18(24)14-3-1-2-13(20-14)10-5-7-15(21)17(23)8-10/h1-9,21-23H |
| InChIKey | USZFAGSFWNNZLX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone?
The IUPAC name of [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone (CID 135567153) is [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone.
What is the SMILES notation for [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone?
The canonical SMILES for [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone is O=C(c1ccc(F)c(O)c1)c1cccc(-c2ccc(O)c(O)c2)n1.
What is the InChIKey of [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone?
The InChIKey is USZFAGSFWNNZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FNO4/c19-12-6-4-11(9-16(12)22)18(24)14-3-1-2-13(20-14)10-5-7-15(21)17(23)8-10/h1-9,21-23H.
What are the key properties of [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone?
[6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone has a molecular weight of 325.30 g/mol, XLogP of 3.24, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3,4-dihydroxyphenyl)-2-pyridinyl]-(4-fluoro-3-hydroxyphenyl)methanone is sourced from PubChem (CID 135567153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).