C20H19F2N4O6+ — CID 135567240
methyl 2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-7-methoxy-2-oxo-1,8-naphthyridin-8-ium-4-ylidene]amino]acetate (PubChem CID 135567240) has the molecular formula C20H19F2N4O6+ and a molecular weight of 449.39 g/mol. Its IUPAC name is methyl 2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-7-methoxy-2-oxo-1,8-naphthyridin-8-ium-4-ylidene]amino]acetate.
| Compound Name | methyl 2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-7-methoxy-2-oxo-1,8-naphthyridin-8-ium-4-ylidene]amino]acetate |
|---|---|
| PubChem CID | 135567240 |
| Molecular Formula | C20H19F2N4O6+ |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | methyl 2-[[3-[(2,4-difluorophenyl)methylcarbamoyl]-1-hydroxy-7-methoxy-2-oxo-1,8-naphthyridin-8-ium-4-ylidene]amino]acetate |
| SMILES | COC(=O)C/N=C1\c2ccc(OC)[nH+]c2N(O)C(=O)C1C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C20H18F2N4O6/c1-31-14-6-5-12-17(23-9-15(27)32-2)16(20(29)26(30)18(12)25-14)19(28)24-8-10-3-4-11(21)7-13(10)22/h3-7,16,30H,8-9H2,1-2H3,(H,24,28)/p+1/b23-17+ |
| InChIKey | VCQAVDLCPMBXTG-HAVVHWLPSA-O |
| XLogP | 0.42 |
| TPSA | 131.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|