C24H27N5O4 — CID 135567253
6-hydroxy-N-methyl-N-(4-morpholin-4-ylphenyl)-3-(pyrrolidine-1-carbonyl)-1H-indazole-5-carboxamide (PubChem CID 135567253) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 6-hydroxy-N-methyl-N-(4-morpholin-4-ylphenyl)-3-(pyrrolidine-1-carbonyl)-1H-indazole-5-carboxamide.
| Compound Name | 6-hydroxy-N-methyl-N-(4-morpholin-4-ylphenyl)-3-(pyrrolidine-1-carbonyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 135567253 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 6-hydroxy-N-methyl-N-(4-morpholin-4-ylphenyl)-3-(pyrrolidine-1-carbonyl)-1H-indazole-5-carboxamide |
| SMILES | CN(C(=O)c1cc2c(C(=O)N3CCCC3)n[nH]c2cc1O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N5O4/c1-27(16-4-6-17(7-5-16)28-10-12-33-13-11-28)23(31)19-14-18-20(15-21(19)30)25-26-22(18)24(32)29-8-2-3-9-29/h4-7,14-15,30H,2-3,8-13H2,1H3,(H,25,26) |
| InChIKey | PAGPOZMFSDBEOC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|