C22H16N2O2 — CID 135567659
2-[[4-(2-phenyl-1,3-oxazol-5-yl)phenyl]iminomethyl]phenol (PubChem CID 135567659) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[[4-(2-phenyl-1,3-oxazol-5-yl)phenyl]iminomethyl]phenol.
| Compound Name | 2-[[4-(2-phenyl-1,3-oxazol-5-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135567659 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[[4-(2-phenyl-1,3-oxazol-5-yl)phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1ccc(-c2cnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H16N2O2/c25-20-9-5-4-8-18(20)14-23-19-12-10-16(11-13-19)21-15-24-22(26-21)17-6-2-1-3-7-17/h1-15,25H/b23-14+ |
| InChIKey | FYXKFSHGEXJHGZ-OEAKJJBVSA-N |
| XLogP | 5.46 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|